C13H20O6 — CID 69288362
2-butan-2-yloxycarbonyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid (PubChem CID 69288362) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69288362 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enoic acid |
| SMILES | CCC(C)OC(=O)C(=CC1COC(C)(C)O1)C(=O)O |
| InChI | InChI=1S/C13H20O6/c1-5-8(2)18-12(16)10(11(14)15)6-9-7-17-13(3,4)19-9/h6,8-9H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | SNDATDDKNWKVNV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|