About 5-amino-6-methylthieno[3,2-b]thiophen-2-ol
5-amino-6-methylthieno[3,2-b]thiophen-2-ol (PubChem CID 69288363) has the molecular formula C7H7NOS2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-amino-6-methylthieno[3,2-b]thiophen-2-ol.
Molecular Properties
| Compound Name | 5-amino-6-methylthieno[3,2-b]thiophen-2-ol |
| PubChem CID | 69288363 |
| Molecular Formula | C7H7NOS2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 5-amino-6-methylthieno[3,2-b]thiophen-2-ol |
| SMILES | Cc1c(N)sc2cc(O)sc12 |
| InChI | InChI=1S/C7H7NOS2/c1-3-6-4(10-7(3)8)2-5(9)11-6/h2,9H,8H2,1H3 |
| InChIKey | ZKYJKDYXNWVVIF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-6-methylthieno[3,2-b]thiophen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-methylthieno[3,2-b]thiophen-2-ol?
The IUPAC name of 5-amino-6-methylthieno[3,2-b]thiophen-2-ol (CID 69288363) is 5-amino-6-methylthieno[3,2-b]thiophen-2-ol.
What is the SMILES notation for 5-amino-6-methylthieno[3,2-b]thiophen-2-ol?
The canonical SMILES for 5-amino-6-methylthieno[3,2-b]thiophen-2-ol is Cc1c(N)sc2cc(O)sc12.
What is the InChIKey of 5-amino-6-methylthieno[3,2-b]thiophen-2-ol?
The InChIKey is ZKYJKDYXNWVVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS2/c1-3-6-4(10-7(3)8)2-5(9)11-6/h2,9H,8H2,1H3.
What are the key properties of 5-amino-6-methylthieno[3,2-b]thiophen-2-ol?
5-amino-6-methylthieno[3,2-b]thiophen-2-ol has a molecular weight of 185.27 g/mol, XLogP of 2.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-methylthieno[3,2-b]thiophen-2-ol is sourced from PubChem (CID 69288363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).