About 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one
5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one (PubChem CID 69288376) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one.
Molecular Properties
| Compound Name | 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one |
| PubChem CID | 69288376 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one |
| SMILES | Cn1c(=O)[nH]c2oc(N)cc21 |
| InChI | InChI=1S/C6H7N3O2/c1-9-3-2-4(7)11-5(3)8-6(9)10/h2H,7H2,1H3,(H,8,10) |
| InChIKey | AZVDMKUNYYXAJH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one?
The IUPAC name of 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one (CID 69288376) is 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one.
What is the SMILES notation for 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one?
The canonical SMILES for 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one is Cn1c(=O)[nH]c2oc(N)cc21.
What is the InChIKey of 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one?
The InChIKey is AZVDMKUNYYXAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c1-9-3-2-4(7)11-5(3)8-6(9)10/h2H,7H2,1H3,(H,8,10).
What are the key properties of 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one?
5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one has a molecular weight of 153.14 g/mol, XLogP of 0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-methyl-3H-furo[2,3-d]imidazol-2-one is sourced from PubChem (CID 69288376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).