About 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol
2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol (PubChem CID 69288387) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol |
| PubChem CID | 69288387 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol |
| SMILES | CCN(CCO)c1cc2[nH]c(N)nc2o1 |
| InChI | InChI=1S/C9H14N4O2/c1-2-13(3-4-14)7-5-6-8(15-7)12-9(10)11-6/h5,14H,2-4H2,1H3,(H3,10,11,12) |
| InChIKey | IIOMJUMMLSGYMQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol?
The IUPAC name of 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol (CID 69288387) is 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol.
What is the SMILES notation for 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol?
The canonical SMILES for 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol is CCN(CCO)c1cc2[nH]c(N)nc2o1.
What is the InChIKey of 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol?
The InChIKey is IIOMJUMMLSGYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-2-13(3-4-14)7-5-6-8(15-7)12-9(10)11-6/h5,14H,2-4H2,1H3,(H3,10,11,12).
What are the key properties of 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol?
2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol has a molecular weight of 210.24 g/mol, XLogP of 0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1H-furo[2,3-d]imidazol-5-yl)-ethylamino]ethanol is sourced from PubChem (CID 69288387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).