About 4H-furo[3,2-b]pyrrol-2-amine
4H-furo[3,2-b]pyrrol-2-amine (PubChem CID 69288394) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 4H-furo[3,2-b]pyrrol-2-amine.
Molecular Properties
| Compound Name | 4H-furo[3,2-b]pyrrol-2-amine |
| PubChem CID | 69288394 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 4H-furo[3,2-b]pyrrol-2-amine |
| SMILES | Nc1cc2[nH]ccc2o1 |
| InChI | InChI=1S/C6H6N2O/c7-6-3-4-5(9-6)1-2-8-4/h1-3,8H,7H2 |
| InChIKey | MFLBHGAEOREMBV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-furo[3,2-b]pyrrol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-furo[3,2-b]pyrrol-2-amine?
The IUPAC name of 4H-furo[3,2-b]pyrrol-2-amine (CID 69288394) is 4H-furo[3,2-b]pyrrol-2-amine.
What is the SMILES notation for 4H-furo[3,2-b]pyrrol-2-amine?
The canonical SMILES for 4H-furo[3,2-b]pyrrol-2-amine is Nc1cc2[nH]ccc2o1.
What is the InChIKey of 4H-furo[3,2-b]pyrrol-2-amine?
The InChIKey is MFLBHGAEOREMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c7-6-3-4-5(9-6)1-2-8-4/h1-3,8H,7H2.
What are the key properties of 4H-furo[3,2-b]pyrrol-2-amine?
4H-furo[3,2-b]pyrrol-2-amine has a molecular weight of 122.13 g/mol, XLogP of 1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-furo[3,2-b]pyrrol-2-amine is sourced from PubChem (CID 69288394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).