About 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol
2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol (PubChem CID 69288451) has the molecular formula C9H14N4O3
and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 69288451 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol |
| SMILES | Nc1cc2[nH]c(N(CCO)CCO)nc2o1 |
| InChI | InChI=1S/C9H14N4O3/c10-7-5-6-8(16-7)12-9(11-6)13(1-3-14)2-4-15/h5,14-15H,1-4,10H2,(H,11,12) |
| InChIKey | ACIDKFXVNZHTBU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol (CID 69288451) is 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol is Nc1cc2[nH]c(N(CCO)CCO)nc2o1.
What is the InChIKey of 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol?
The InChIKey is ACIDKFXVNZHTBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O3/c10-7-5-6-8(16-7)12-9(11-6)13(1-3-14)2-4-15/h5,14-15H,1-4,10H2,(H,11,12).
What are the key properties of 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol?
2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol has a molecular weight of 226.24 g/mol, XLogP of -0.47, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1H-furo[2,3-d]imidazol-2-yl)-(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 69288451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).