C12H18F3N3 — CID 69288769
5-[4-(2,2,2-trifluoroethylamino)pentan-2-yl]pyridin-2-amine (PubChem CID 69288769) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 5-[4-(2,2,2-trifluoroethylamino)pentan-2-yl]pyridin-2-amine.
| Compound Name | 5-[4-(2,2,2-trifluoroethylamino)pentan-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 69288769 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-[4-(2,2,2-trifluoroethylamino)pentan-2-yl]pyridin-2-amine |
| SMILES | CC(CC(C)c1ccc(N)nc1)NCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N3/c1-8(10-3-4-11(16)17-6-10)5-9(2)18-7-12(13,14)15/h3-4,6,8-9,18H,5,7H2,1-2H3,(H2,16,17) |
| InChIKey | MNCMUCGEOCSZSQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |