About 4-methylfuro[3,2-b]pyrrol-2-amine
4-methylfuro[3,2-b]pyrrol-2-amine (PubChem CID 69289624) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 4-methylfuro[3,2-b]pyrrol-2-amine.
Molecular Properties
| Compound Name | 4-methylfuro[3,2-b]pyrrol-2-amine |
| PubChem CID | 69289624 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 4-methylfuro[3,2-b]pyrrol-2-amine |
| SMILES | Cn1ccc2oc(N)cc21 |
| InChI | InChI=1S/C7H8N2O/c1-9-3-2-6-5(9)4-7(8)10-6/h2-4H,8H2,1H3 |
| InChIKey | SZVHYVWMOGZGDY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 44.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylfuro[3,2-b]pyrrol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylfuro[3,2-b]pyrrol-2-amine?
The IUPAC name of 4-methylfuro[3,2-b]pyrrol-2-amine (CID 69289624) is 4-methylfuro[3,2-b]pyrrol-2-amine.
What is the SMILES notation for 4-methylfuro[3,2-b]pyrrol-2-amine?
The canonical SMILES for 4-methylfuro[3,2-b]pyrrol-2-amine is Cn1ccc2oc(N)cc21.
What is the InChIKey of 4-methylfuro[3,2-b]pyrrol-2-amine?
The InChIKey is SZVHYVWMOGZGDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-9-3-2-6-5(9)4-7(8)10-6/h2-4H,8H2,1H3.
What are the key properties of 4-methylfuro[3,2-b]pyrrol-2-amine?
4-methylfuro[3,2-b]pyrrol-2-amine has a molecular weight of 136.15 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylfuro[3,2-b]pyrrol-2-amine is sourced from PubChem (CID 69289624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).