About 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol
2-amino-4-methylfuro[3,2-b]pyrrol-5-ol (PubChem CID 69289679) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol.
Molecular Properties
| Compound Name | 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol |
| PubChem CID | 69289679 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol |
| SMILES | Cn1c(O)cc2oc(N)cc21 |
| InChI | InChI=1S/C7H8N2O2/c1-9-4-2-6(8)11-5(4)3-7(9)10/h2-3,10H,8H2,1H3 |
| InChIKey | HOPZZUWQYSDCPU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol?
The IUPAC name of 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol (CID 69289679) is 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol.
What is the SMILES notation for 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol?
The canonical SMILES for 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol is Cn1c(O)cc2oc(N)cc21.
What is the InChIKey of 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol?
The InChIKey is HOPZZUWQYSDCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-9-4-2-6(8)11-5(4)3-7(9)10/h2-3,10H,8H2,1H3.
What are the key properties of 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol?
2-amino-4-methylfuro[3,2-b]pyrrol-5-ol has a molecular weight of 152.15 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylfuro[3,2-b]pyrrol-5-ol is sourced from PubChem (CID 69289679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).