About thieno[2,3-d][1,3]thiazol-5-amine
thieno[2,3-d][1,3]thiazol-5-amine (PubChem CID 69289738) has the molecular formula C5H4N2S2
and a molecular weight of 156.24 g/mol. Its IUPAC name is thieno[2,3-d][1,3]thiazol-5-amine.
Molecular Properties
| Compound Name | thieno[2,3-d][1,3]thiazol-5-amine |
| PubChem CID | 69289738 |
| Molecular Formula | C5H4N2S2 |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 155.98 |
| IUPAC Name | thieno[2,3-d][1,3]thiazol-5-amine |
| SMILES | Nc1cc2scnc2s1 |
| InChI | InChI=1S/C5H4N2S2/c6-4-1-3-5(9-4)7-2-8-3/h1-2H,6H2 |
| InChIKey | UUMZTAJTXLWDCG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[2,3-d][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-d][1,3]thiazol-5-amine?
The IUPAC name of thieno[2,3-d][1,3]thiazol-5-amine (CID 69289738) is thieno[2,3-d][1,3]thiazol-5-amine.
What is the SMILES notation for thieno[2,3-d][1,3]thiazol-5-amine?
The canonical SMILES for thieno[2,3-d][1,3]thiazol-5-amine is Nc1cc2scnc2s1.
What is the InChIKey of thieno[2,3-d][1,3]thiazol-5-amine?
The InChIKey is UUMZTAJTXLWDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S2/c6-4-1-3-5(9-4)7-2-8-3/h1-2H,6H2.
What are the key properties of thieno[2,3-d][1,3]thiazol-5-amine?
thieno[2,3-d][1,3]thiazol-5-amine has a molecular weight of 156.24 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d][1,3]thiazol-5-amine is sourced from PubChem (CID 69289738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).