About 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol
2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol (PubChem CID 69289832) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol.
Molecular Properties
| Compound Name | 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol |
| PubChem CID | 69289832 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol |
| SMILES | Nc1cc2[nH]c(O)cc2[nH]1 |
| InChI | InChI=1S/C6H7N3O/c7-5-1-3-4(8-5)2-6(10)9-3/h1-2,8-10H,7H2 |
| InChIKey | FOKBNKXYJGWRRM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol?
The IUPAC name of 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol (CID 69289832) is 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol.
What is the SMILES notation for 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol?
The canonical SMILES for 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol is Nc1cc2[nH]c(O)cc2[nH]1.
What is the InChIKey of 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol?
The InChIKey is FOKBNKXYJGWRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c7-5-1-3-4(8-5)2-6(10)9-3/h1-2,8-10H,7H2.
What are the key properties of 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol?
2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol has a molecular weight of 137.14 g/mol, XLogP of 0.78, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,4-dihydropyrrolo[3,2-b]pyrrol-5-ol is sourced from PubChem (CID 69289832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).