C16H22N2O2 — CID 69289851
tert-butyl 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 69289851) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is tert-butyl 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 69289851 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | tert-butyl 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2NC3C=CC=CC3=C2C1 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2,3)20-15(19)18-9-8-14-12(10-18)11-6-4-5-7-13(11)17-14/h4-7,13-14,17H,8-10H2,1-3H3 |
| InChIKey | WDGUMEFHARDXDZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |