C12H14F2O4 — CID 69290842
ethyl 2-(2,6-difluoro-4-hydroxyphenyl)-2-ethoxyacetate (PubChem CID 69290842) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is ethyl 2-(2,6-difluoro-4-hydroxyphenyl)-2-ethoxyacetate.
| Compound Name | ethyl 2-(2,6-difluoro-4-hydroxyphenyl)-2-ethoxyacetate |
|---|---|
| PubChem CID | 69290842 |
| Molecular Formula | C12H14F2O4 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | ethyl 2-(2,6-difluoro-4-hydroxyphenyl)-2-ethoxyacetate |
| SMILES | CCOC(=O)C(OCC)c1c(F)cc(O)cc1F |
| InChI | InChI=1S/C12H14F2O4/c1-3-17-11(12(16)18-4-2)10-8(13)5-7(15)6-9(10)14/h5-6,11,15H,3-4H2,1-2H3 |
| InChIKey | OARGJUYNGPRMSX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |