About (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate
(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate (PubChem CID 69291365) has the molecular formula C19H21N3O4S2
and a molecular weight of 419.53 g/mol. Its IUPAC name is (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate.
Molecular Properties
| Compound Name | (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate |
| PubChem CID | 69291365 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate |
| SMILES | COc1ccc(N2CCOCC2)c2sc(OC(=O)NCCc3ccsc3)nc12 |
| InChI | InChI=1S/C19H21N3O4S2/c1-24-15-3-2-14(22-7-9-25-10-8-22)17-16(15)21-19(28-17)26-18(23)20-6-4-13-5-11-27-12-13/h2-3,5,11-12H,4,6-10H2,1H3,(H,20,23) |
| InChIKey | CBVGGUQBZITQDM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate?
The IUPAC name of (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate (CID 69291365) is (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate.
What is the SMILES notation for (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate?
The canonical SMILES for (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate is COc1ccc(N2CCOCC2)c2sc(OC(=O)NCCc3ccsc3)nc12.
What is the InChIKey of (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate?
The InChIKey is CBVGGUQBZITQDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S2/c1-24-15-3-2-14(22-7-9-25-10-8-22)17-16(15)21-19(28-17)26-18(23)20-6-4-13-5-11-27-12-13/h2-3,5,11-12H,4,6-10H2,1H3,(H,20,23).
What are the key properties of (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate?
(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate has a molecular weight of 419.53 g/mol, XLogP of 3.53, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl) N-(2-thiophen-3-ylethyl)carbamate is sourced from PubChem (CID 69291365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).