About 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine
3-methoxy-4H-furo[3,2-b]pyrrol-2-amine (PubChem CID 69292246) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine.
Molecular Properties
| Compound Name | 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine |
| PubChem CID | 69292246 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine |
| SMILES | COc1c(N)oc2cc[nH]c12 |
| InChI | InChI=1S/C7H8N2O2/c1-10-6-5-4(2-3-9-5)11-7(6)8/h2-3,9H,8H2,1H3 |
| InChIKey | LCQPLEPDOPTVQP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine?
The IUPAC name of 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine (CID 69292246) is 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine.
What is the SMILES notation for 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine?
The canonical SMILES for 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine is COc1c(N)oc2cc[nH]c12.
What is the InChIKey of 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine?
The InChIKey is LCQPLEPDOPTVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-10-6-5-4(2-3-9-5)11-7(6)8/h2-3,9H,8H2,1H3.
What are the key properties of 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine?
3-methoxy-4H-furo[3,2-b]pyrrol-2-amine has a molecular weight of 152.15 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4H-furo[3,2-b]pyrrol-2-amine is sourced from PubChem (CID 69292246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).