C14H9Cl2NO2 — CID 6929260
(3S)-3-(3,4-dichloroanilino)-3H-2-benzofuran-1-one (PubChem CID 6929260) has the molecular formula C14H9Cl2NO2 and a molecular weight of 294.14 g/mol. Its IUPAC name is (3S)-3-(3,4-dichloroanilino)-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-(3,4-dichloroanilino)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 6929260 |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | (3S)-3-(3,4-dichloroanilino)-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@H](Nc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C14H9Cl2NO2/c15-11-6-5-8(7-12(11)16)17-13-9-3-1-2-4-10(9)14(18)19-13/h1-7,13,17H/t13-/m0/s1 |
| InChIKey | GBGWIEJKQADDRM-ZDUSSCGKSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |