C23H27FN2O6S — CID 69292739
1-[3-fluoro-4-[4-[2-(2-methoxyethoxy)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 69292739) has the molecular formula C23H27FN2O6S and a molecular weight of 478.54 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[2-(2-methoxyethoxy)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-[2-(2-methoxyethoxy)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 69292739 |
| Molecular Formula | C23H27FN2O6S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1-[3-fluoro-4-[4-[2-(2-methoxyethoxy)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | COCCOc1ccc(S(C)(=O)=O)cc1C(=O)N1CCN(c2ccc(C(C)=O)cc2F)CC1 |
| InChI | InChI=1S/C23H27FN2O6S/c1-16(27)17-4-6-21(20(24)14-17)25-8-10-26(11-9-25)23(28)19-15-18(33(3,29)30)5-7-22(19)32-13-12-31-2/h4-7,14-15H,8-13H2,1-3H3 |
| InChIKey | QQXNEMHVPUGTOX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|