C24H27F2N5O3 — CID 69292749
2-N-benzylpyrazine-2,5-diamine;2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoic acid (PubChem CID 69292749) has the molecular formula C24H27F2N5O3 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-N-benzylpyrazine-2,5-diamine;2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoic acid.
| Compound Name | 2-N-benzylpyrazine-2,5-diamine;2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69292749 |
| Molecular Formula | C24H27F2N5O3 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-N-benzylpyrazine-2,5-diamine;2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)O.Nc1cnc(NCc2ccccc2)cn1 |
| InChI | InChI=1S/C13H15F2NO3.C11H12N4/c1-2-3-11(13(18)19)16-12(17)6-8-4-9(14)7-10(15)5-8;12-10-7-15-11(8-13-10)14-6-9-4-2-1-3-5-9/h4-5,7,11H,2-3,6H2,1H3,(H,16,17)(H,18,19);1-5,7-8H,6H2,(H2,12,13)(H,14,15) |
| InChIKey | NCELMMWOVCSXKH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |