C32H46O9S — CID 69292949
1-cyclohexyloxycarbonyloxyethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate (PubChem CID 69292949) has the molecular formula C32H46O9S and a molecular weight of 606.78 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 69292949 |
| Molecular Formula | C32H46O9S |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
| SMILES | COCc1cccc(C[C@H](O)/C=C/[C@@H]2[C@H](O)CC(=O)[C@@H]2CCSCCCC(=O)OC(C)OC(=O)OC2CCCCC2)c1 |
| InChI | InChI=1S/C32H46O9S/c1-22(40-32(37)41-26-10-4-3-5-11-26)39-31(36)12-7-16-42-17-15-28-27(29(34)20-30(28)35)14-13-25(33)19-23-8-6-9-24(18-23)21-38-2/h6,8-9,13-14,18,22,25-29,33-34H,3-5,7,10-12,15-17,19-21H2,1-2H3/b14-13+/t22?,25-,27+,28-,29-/m1/s1 |
| InChIKey | QFMAVYMVHWGPEJ-KMGUCCPSSA-N |
| XLogP | 5.14 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|