About (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane
(4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane (PubChem CID 69293358) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane |
| PubChem CID | 69293358 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane |
| SMILES | CS(=O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C6H12O3S/c1-6(2)8-4-5(9-6)10(3)7/h5H,4H2,1-3H3/t5-,10?/m1/s1 |
| InChIKey | QGQRWSMFBZECLO-UYBGKAFVSA-N |
| XLogP | 0.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane?
The IUPAC name of (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane (CID 69293358) is (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane.
What is the SMILES notation for (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane?
The canonical SMILES for (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane is CS(=O)[C@@H]1COC(C)(C)O1.
What is the InChIKey of (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane?
The InChIKey is QGQRWSMFBZECLO-UYBGKAFVSA-N. The full InChI is InChI=1S/C6H12O3S/c1-6(2)8-4-5(9-6)10(3)7/h5H,4H2,1-3H3/t5-,10?/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane?
(4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane has a molecular weight of 164.23 g/mol, XLogP of 0.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-4-methylsulfinyl-1,3-dioxolane is sourced from PubChem (CID 69293358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).