C19H30O9 — CID 69293570
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-pentyloxan-2-yl]methyl acetate (PubChem CID 69293570) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-pentyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-pentyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69293570 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-pentyloxan-2-yl]methyl acetate |
| SMILES | CCCCC[C@H]1[C@@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H30O9/c1-6-7-8-9-15-17(25-12(3)21)18(26-13(4)22)16(10-24-11(2)20)28-19(15)27-14(5)23/h15-19H,6-10H2,1-5H3/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | FZVOWJVJPOXBGU-NNIGNNQHSA-N |
| XLogP | 1.90 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|