About 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole
2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole (PubChem CID 69293618) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole |
| PubChem CID | 69293618 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole |
| SMILES | CN1C=CN(C)C1c1ncc[nH]1 |
| InChI | InChI=1S/C8H12N4/c1-11-5-6-12(2)8(11)7-9-3-4-10-7/h3-6,8H,1-2H3,(H,9,10) |
| InChIKey | YTBSUKCUPXNGHL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole?
The IUPAC name of 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole (CID 69293618) is 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole.
What is the SMILES notation for 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole?
The canonical SMILES for 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole is CN1C=CN(C)C1c1ncc[nH]1.
What is the InChIKey of 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole?
The InChIKey is YTBSUKCUPXNGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-11-5-6-12(2)8(11)7-9-3-4-10-7/h3-6,8H,1-2H3,(H,9,10).
What are the key properties of 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole?
2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole has a molecular weight of 164.21 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yl)-1,3-dimethyl-2H-imidazole is sourced from PubChem (CID 69293618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).