About 2-imidazol-2-ylidene-1,3-dimethylimidazole
2-imidazol-2-ylidene-1,3-dimethylimidazole (PubChem CID 69293619) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-imidazol-2-ylidene-1,3-dimethylimidazole.
Molecular Properties
| Compound Name | 2-imidazol-2-ylidene-1,3-dimethylimidazole |
| PubChem CID | 69293619 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-imidazol-2-ylidene-1,3-dimethylimidazole |
| SMILES | CN1C=CN(C)C1=C1N=CC=N1 |
| InChI | InChI=1S/C8H10N4/c1-11-5-6-12(2)8(11)7-9-3-4-10-7/h3-6H,1-2H3 |
| InChIKey | VEGVXCRDWLIBAH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazol-2-ylidene-1,3-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-2-ylidene-1,3-dimethylimidazole?
The IUPAC name of 2-imidazol-2-ylidene-1,3-dimethylimidazole (CID 69293619) is 2-imidazol-2-ylidene-1,3-dimethylimidazole.
What is the SMILES notation for 2-imidazol-2-ylidene-1,3-dimethylimidazole?
The canonical SMILES for 2-imidazol-2-ylidene-1,3-dimethylimidazole is CN1C=CN(C)C1=C1N=CC=N1.
What is the InChIKey of 2-imidazol-2-ylidene-1,3-dimethylimidazole?
The InChIKey is VEGVXCRDWLIBAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-11-5-6-12(2)8(11)7-9-3-4-10-7/h3-6H,1-2H3.
What are the key properties of 2-imidazol-2-ylidene-1,3-dimethylimidazole?
2-imidazol-2-ylidene-1,3-dimethylimidazole has a molecular weight of 162.20 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-2-ylidene-1,3-dimethylimidazole is sourced from PubChem (CID 69293619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).