About CID 69293722
CID 69293722 (PubChem CID 69293722) has the molecular formula C36H32B
and a molecular weight of 475.46 g/mol.
Molecular Properties
| Compound Name | CID 69293722 |
| PubChem CID | 69293722 |
| Molecular Formula | C36H32B |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | — |
| SMILES | Cc1cc(C=Cc2ccccc2)cc(C)c1[B]c1c(C)cc(-c2ccc(-c3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C36H32B/c1-25-21-30(16-15-29-11-7-5-8-12-29)22-26(2)35(25)37-36-27(3)23-34(24-28(36)4)33-19-17-32(18-20-33)31-13-9-6-10-14-31/h5-24H,1-4H3 |
| InChIKey | GTDNSUWQWFLERC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 69293722 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69293722?
The IUPAC name of CID 69293722 (CID 69293722) is not available.
What is the SMILES notation for CID 69293722?
The canonical SMILES for CID 69293722 is Cc1cc(C=Cc2ccccc2)cc(C)c1[B]c1c(C)cc(-c2ccc(-c3ccccc3)cc2)cc1C.
What is the InChIKey of CID 69293722?
The InChIKey is GTDNSUWQWFLERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H32B/c1-25-21-30(16-15-29-11-7-5-8-12-29)22-26(2)35(25)37-36-27(3)23-34(24-28(36)4)33-19-17-32(18-20-33)31-13-9-6-10-14-31/h5-24H,1-4H3.
What are the key properties of CID 69293722?
CID 69293722 has a molecular weight of 475.46 g/mol, XLogP of 8.08, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69293722 is sourced from PubChem (CID 69293722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).