C10H13Cl2NO — CID 6929386
N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-2,2-dichloro-N-methylacetamide (PubChem CID 6929386) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-2,2-dichloro-N-methylacetamide.
| Compound Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-2,2-dichloro-N-methylacetamide |
|---|---|
| PubChem CID | 6929386 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-2,2-dichloro-N-methylacetamide |
| SMILES | CN(C(=O)C(Cl)Cl)[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C10H13Cl2NO/c1-13(10(14)9(11)12)8-5-6-2-3-7(8)4-6/h2-3,6-9H,4-5H2,1H3/t6-,7-,8+/m0/s1 |
| InChIKey | MNFCRBQNMFDHJA-BIIVOSGPSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|