C10H9F3O2S — CID 69293878
1,1,1-trifluoro-3-(thiophen-2-ylmethyl)pentane-2,4-dione (PubChem CID 69293878) has the molecular formula C10H9F3O2S and a molecular weight of 250.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(thiophen-2-ylmethyl)pentane-2,4-dione.
| Compound Name | 1,1,1-trifluoro-3-(thiophen-2-ylmethyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 69293878 |
| Molecular Formula | C10H9F3O2S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1,1,1-trifluoro-3-(thiophen-2-ylmethyl)pentane-2,4-dione |
| SMILES | CC(=O)C(Cc1cccs1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O2S/c1-6(14)8(9(15)10(11,12)13)5-7-3-2-4-16-7/h2-4,8H,5H2,1H3 |
| InChIKey | CSPCRNRIYPIVIB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|