About sulfane;2,4,6-trimethylpyridine
sulfane;2,4,6-trimethylpyridine (PubChem CID 69294176) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is sulfane;2,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | sulfane;2,4,6-trimethylpyridine |
| PubChem CID | 69294176 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | sulfane;2,4,6-trimethylpyridine |
| SMILES | Cc1cc(C)nc(C)c1.S |
| InChI | InChI=1S/C8H11N.H2S/c1-6-4-7(2)9-8(3)5-6;/h4-5H,1-3H3;1H2 |
| InChIKey | CCQCYYHYLGQSPP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sulfane;2,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;2,4,6-trimethylpyridine?
The IUPAC name of sulfane;2,4,6-trimethylpyridine (CID 69294176) is sulfane;2,4,6-trimethylpyridine.
What is the SMILES notation for sulfane;2,4,6-trimethylpyridine?
The canonical SMILES for sulfane;2,4,6-trimethylpyridine is Cc1cc(C)nc(C)c1.S.
What is the InChIKey of sulfane;2,4,6-trimethylpyridine?
The InChIKey is CCQCYYHYLGQSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.H2S/c1-6-4-7(2)9-8(3)5-6;/h4-5H,1-3H3;1H2.
What are the key properties of sulfane;2,4,6-trimethylpyridine?
sulfane;2,4,6-trimethylpyridine has a molecular weight of 155.27 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;2,4,6-trimethylpyridine is sourced from PubChem (CID 69294176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).