About 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one
1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one (PubChem CID 692942) has the molecular formula C17H11N3O2
and a molecular weight of 289.29 g/mol. Its IUPAC name is 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one.
Molecular Properties
| Compound Name | 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one |
| PubChem CID | 692942 |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one |
| SMILES | O=c1oc(-c2ccccc2)nc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C17H11N3O2/c21-17-14-11-18-20(13-9-5-2-6-10-13)15(14)19-16(22-17)12-7-3-1-4-8-12/h1-11H |
| InChIKey | BCCJIDPZJCOJRY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one?
The IUPAC name of 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one (CID 692942) is 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one.
What is the SMILES notation for 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one?
The canonical SMILES for 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one is O=c1oc(-c2ccccc2)nc2c1cnn2-c1ccccc1.
What is the InChIKey of 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one?
The InChIKey is BCCJIDPZJCOJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O2/c21-17-14-11-18-20(13-9-5-2-6-10-13)15(14)19-16(22-17)12-7-3-1-4-8-12/h1-11H.
What are the key properties of 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one?
1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one has a molecular weight of 289.29 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diphenylpyrazolo[5,4-d][1,3]oxazin-4-one is sourced from PubChem (CID 692942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).