C13H18N3O+ — CID 6929476
[2-[[(2S)-1-(1H-indol-3-yl)propan-2-yl]amino]-2-oxoethyl]azanium (PubChem CID 6929476) has the molecular formula C13H18N3O+ and a molecular weight of 232.31 g/mol. Its IUPAC name is [2-[[(2S)-1-(1H-indol-3-yl)propan-2-yl]amino]-2-oxoethyl]azanium.
| Compound Name | [2-[[(2S)-1-(1H-indol-3-yl)propan-2-yl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 6929476 |
| Molecular Formula | C13H18N3O+ |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | [2-[[(2S)-1-(1H-indol-3-yl)propan-2-yl]amino]-2-oxoethyl]azanium |
| SMILES | C[C@@H](Cc1c[nH]c2ccccc12)NC(=O)C[NH3+] |
| InChI | InChI=1S/C13H17N3O/c1-9(16-13(17)7-14)6-10-8-15-12-5-3-2-4-11(10)12/h2-5,8-9,15H,6-7,14H2,1H3,(H,16,17)/p+1/t9-/m0/s1 |
| InChIKey | SFTSSVCRTXAUQR-VIFPVBQESA-O |
| XLogP | 0.46 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |