C41H52O6 — CID 69294895
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]acetate (PubChem CID 69294895) has the molecular formula C41H52O6 and a molecular weight of 640.86 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]acetate.
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]acetate |
|---|---|
| PubChem CID | 69294895 |
| Molecular Formula | C41H52O6 |
| Molecular Weight | 640.86 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]acetate |
| SMILES | Cc1cc2c(cc1O)C(C)(C)CC1(CC(C)(C)c3cc(OCC(=O)OC4CC(C)CCC4C(C)(C)c4ccccc4)c(C)cc3O1)O2 |
| InChI | InChI=1S/C41H52O6/c1-25-15-16-29(40(8,9)28-13-11-10-12-14-28)34(17-25)45-37(43)22-44-33-21-31-36(19-27(33)3)47-41(24-39(31,6)7)23-38(4,5)30-20-32(42)26(2)18-35(30)46-41/h10-14,18-21,25,29,34,42H,15-17,22-24H2,1-9H3 |
| InChIKey | ILWCRASDENNGGD-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.86 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |