C23H28ClN5 — CID 69294969
3-chloro-4-(2-heptan-4-yl-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-7-yl)benzonitrile (PubChem CID 69294969) has the molecular formula C23H28ClN5 and a molecular weight of 409.97 g/mol. Its IUPAC name is 3-chloro-4-(2-heptan-4-yl-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-7-yl)benzonitrile.
| Compound Name | 3-chloro-4-(2-heptan-4-yl-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-7-yl)benzonitrile |
|---|---|
| PubChem CID | 69294969 |
| Molecular Formula | C23H28ClN5 |
| Molecular Weight | 409.97 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-chloro-4-(2-heptan-4-yl-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-7-yl)benzonitrile |
| SMILES | CCCC(CCC)N1CC2CCN(c3ccc(C#N)cc3Cl)c3nc(C)nc1c32 |
| InChI | InChI=1S/C23H28ClN5/c1-4-6-18(7-5-2)29-14-17-10-11-28(20-9-8-16(13-25)12-19(20)24)22-21(17)23(29)27-15(3)26-22/h8-9,12,17-18H,4-7,10-11,14H2,1-3H3 |
| InChIKey | KCFGEWFNSJKNME-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |