About 2,3,4-triethyl-2H-thiopyran
2,3,4-triethyl-2H-thiopyran (PubChem CID 69295177) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is 2,3,4-triethyl-2H-thiopyran.
Molecular Properties
| Compound Name | 2,3,4-triethyl-2H-thiopyran |
| PubChem CID | 69295177 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,3,4-triethyl-2H-thiopyran |
| SMILES | CCC1=C(CC)C(CC)SC=C1 |
| InChI | InChI=1S/C11H18S/c1-4-9-7-8-12-11(6-3)10(9)5-2/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | VCOZTJOUCHYAOE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-triethyl-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-triethyl-2H-thiopyran?
The IUPAC name of 2,3,4-triethyl-2H-thiopyran (CID 69295177) is 2,3,4-triethyl-2H-thiopyran.
What is the SMILES notation for 2,3,4-triethyl-2H-thiopyran?
The canonical SMILES for 2,3,4-triethyl-2H-thiopyran is CCC1=C(CC)C(CC)SC=C1.
What is the InChIKey of 2,3,4-triethyl-2H-thiopyran?
The InChIKey is VCOZTJOUCHYAOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18S/c1-4-9-7-8-12-11(6-3)10(9)5-2/h7-8,11H,4-6H2,1-3H3.
What are the key properties of 2,3,4-triethyl-2H-thiopyran?
2,3,4-triethyl-2H-thiopyran has a molecular weight of 182.33 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-triethyl-2H-thiopyran is sourced from PubChem (CID 69295177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).