C28H39FN2O3 — CID 69295616
1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-heptoxyphenoxy)ethanone (PubChem CID 69295616) has the molecular formula C28H39FN2O3 and a molecular weight of 470.63 g/mol. Its IUPAC name is 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-heptoxyphenoxy)ethanone.
| Compound Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-heptoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 69295616 |
| Molecular Formula | C28H39FN2O3 |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-(4-heptoxyphenoxy)ethanone |
| SMILES | CCCCCCCOc1ccc(OCC(=O)N2C[C@@H](C)N(Cc3ccc(F)cc3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C28H39FN2O3/c1-4-5-6-7-8-17-33-26-13-15-27(16-14-26)34-21-28(32)31-19-22(2)30(18-23(31)3)20-24-9-11-25(29)12-10-24/h9-16,22-23H,4-8,17-21H2,1-3H3/t22-,23+/m1/s1 |
| InChIKey | MWILKKCVIKZBEQ-PKTZIBPZSA-N |
| XLogP | 5.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|