C29H32F2N2O2 — CID 69296445
1-[1-[benzyl(cyclohexa-1,3-dien-1-ylmethyl)amino]-2-(3,5-difluorophenyl)ethyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 69296445) has the molecular formula C29H32F2N2O2 and a molecular weight of 478.58 g/mol. Its IUPAC name is 1-[1-[benzyl(cyclohexa-1,3-dien-1-ylmethyl)amino]-2-(3,5-difluorophenyl)ethyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | 1-[1-[benzyl(cyclohexa-1,3-dien-1-ylmethyl)amino]-2-(3,5-difluorophenyl)ethyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 69296445 |
| Molecular Formula | C29H32F2N2O2 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-[1-[benzyl(cyclohexa-1,3-dien-1-ylmethyl)amino]-2-(3,5-difluorophenyl)ethyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1OC(C(Cc2cc(F)cc(F)c2)N(CC2=CC=CCC2)Cc2ccccc2)C2CCCCN12 |
| InChI | InChI=1S/C29H32F2N2O2/c30-24-15-23(16-25(31)18-24)17-27(28-26-13-7-8-14-33(26)29(34)35-28)32(19-21-9-3-1-4-10-21)20-22-11-5-2-6-12-22/h1-5,9-11,15-16,18,26-28H,6-8,12-14,17,19-20H2 |
| InChIKey | YEGYWIYTMUWYEC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |