About 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran
5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran (PubChem CID 69297038) has the molecular formula C16H15FO
and a molecular weight of 242.29 g/mol. Its IUPAC name is 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran |
| PubChem CID | 69297038 |
| Molecular Formula | C16H15FO |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cccc(-c2cc(F)cc3c2OC(C)C3)c1 |
| InChI | InChI=1S/C16H15FO/c1-10-4-3-5-12(6-10)15-9-14(17)8-13-7-11(2)18-16(13)15/h3-6,8-9,11H,7H2,1-2H3 |
| InChIKey | YLJXISHWKDKINI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran?
The IUPAC name of 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran (CID 69297038) is 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran is Cc1cccc(-c2cc(F)cc3c2OC(C)C3)c1.
What is the InChIKey of 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran?
The InChIKey is YLJXISHWKDKINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FO/c1-10-4-3-5-12(6-10)15-9-14(17)8-13-7-11(2)18-16(13)15/h3-6,8-9,11H,7H2,1-2H3.
What are the key properties of 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran?
5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran has a molecular weight of 242.29 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-7-(3-methylphenyl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 69297038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).