C44H38N4 — CID 69297374
3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin (PubChem CID 69297374) has the molecular formula C44H38N4 and a molecular weight of 622.82 g/mol. Its IUPAC name is 3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin.
| Compound Name | 3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin |
|---|---|
| PubChem CID | 69297374 |
| Molecular Formula | C44H38N4 |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | 3,3-dimethyl-10-(4-methylphenyl)-20-phenyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C(c3ccccc3)=C3/CC(C)(C)C(=N3)/C=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C44H38N4/c1-26-12-14-31(15-13-26)41-33-17-16-32(45-33)24-39-44(5,6)25-38(48-39)42(30-10-8-7-9-11-30)35-19-21-37(47-35)43(36-20-18-34(41)46-36)40-28(3)22-27(2)23-29(40)4/h7-24H,25H2,1-6H3/b32-24-,39-24-,41-33-,41-34-,42-35-,42-38-,43-36+,43-37+ |
| InChIKey | RJYZECVKMMWADU-RQZHAJNCSA-N |
| XLogP | 10.25 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |