About 5,15-dibromoporphyrin
5,15-dibromoporphyrin (PubChem CID 69297646) has the molecular formula C20H10Br2N4
and a molecular weight of 466.14 g/mol. Its IUPAC name is 5,15-dibromoporphyrin.
Molecular Properties
| Compound Name | 5,15-dibromoporphyrin |
| PubChem CID | 69297646 |
| Molecular Formula | C20H10Br2N4 |
| Molecular Weight | 466.14 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | 5,15-dibromoporphyrin |
| SMILES | Br/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(Br)=C2/C=CC(=N2)/C=C2/C=CC1=N2 |
| InChI | InChI=1S/C20H10Br2N4/c21-19-15-5-1-11(23-15)9-12-2-6-17(24-12)20(22)18-8-4-14(26-18)10-13-3-7-16(19)25-13/h1-10H/b11-9-,12-9-,13-10-,14-10-,19-15+,19-16+,20-17+,20-18+ |
| InChIKey | OKNJYTHGSREOBF-MCPZTIHVSA-N |
| XLogP | 5.02 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,15-dibromoporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,15-dibromoporphyrin?
The IUPAC name of 5,15-dibromoporphyrin (CID 69297646) is 5,15-dibromoporphyrin.
What is the SMILES notation for 5,15-dibromoporphyrin?
The canonical SMILES for 5,15-dibromoporphyrin is Br/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(Br)=C2/C=CC(=N2)/C=C2/C=CC1=N2.
What is the InChIKey of 5,15-dibromoporphyrin?
The InChIKey is OKNJYTHGSREOBF-MCPZTIHVSA-N. The full InChI is InChI=1S/C20H10Br2N4/c21-19-15-5-1-11(23-15)9-12-2-6-17(24-12)20(22)18-8-4-14(26-18)10-13-3-7-16(19)25-13/h1-10H/b11-9-,12-9-,13-10-,14-10-,19-15+,19-16+,20-17+,20-18+.
What are the key properties of 5,15-dibromoporphyrin?
5,15-dibromoporphyrin has a molecular weight of 466.14 g/mol, XLogP of 5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,15-dibromoporphyrin is sourced from PubChem (CID 69297646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).