About [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate
[4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate (PubChem CID 69298234) has the molecular formula C25H29NO3
and a molecular weight of 391.51 g/mol. Its IUPAC name is [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate.
Molecular Properties
| Compound Name | [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate |
| PubChem CID | 69298234 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate |
| SMILES | CCCCc1ccc2oc(-c3ccc(COC(=O)C4CCNCC4)cc3)cc2c1 |
| InChI | InChI=1S/C25H29NO3/c1-2-3-4-18-7-10-23-22(15-18)16-24(29-23)20-8-5-19(6-9-20)17-28-25(27)21-11-13-26-14-12-21/h5-10,15-16,21,26H,2-4,11-14,17H2,1H3 |
| InChIKey | WKWKJWJDOKZNGA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate?
The IUPAC name of [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate (CID 69298234) is [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate.
What is the SMILES notation for [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate?
The canonical SMILES for [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate is CCCCc1ccc2oc(-c3ccc(COC(=O)C4CCNCC4)cc3)cc2c1.
What is the InChIKey of [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate?
The InChIKey is WKWKJWJDOKZNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO3/c1-2-3-4-18-7-10-23-22(15-18)16-24(29-23)20-8-5-19(6-9-20)17-28-25(27)21-11-13-26-14-12-21/h5-10,15-16,21,26H,2-4,11-14,17H2,1H3.
What are the key properties of [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate?
[4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate has a molecular weight of 391.51 g/mol, XLogP of 5.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-butyl-1-benzofuran-2-yl)phenyl]methyl piperidine-4-carboxylate is sourced from PubChem (CID 69298234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).