About 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one
1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one (PubChem CID 69298401) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one |
| PubChem CID | 69298401 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one |
| SMILES | CC(O)N1CCCC1=O.CN1CCCC1=O |
| InChI | InChI=1S/C6H11NO2.C5H9NO/c1-5(8)7-4-2-3-6(7)9;1-6-4-2-3-5(6)7/h5,8H,2-4H2,1H3;2-4H2,1H3 |
| InChIKey | HHOMZQHRDVWZJR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one?
The IUPAC name of 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one (CID 69298401) is 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one.
What is the SMILES notation for 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one?
The canonical SMILES for 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one is CC(O)N1CCCC1=O.CN1CCCC1=O.
What is the InChIKey of 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one?
The InChIKey is HHOMZQHRDVWZJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C5H9NO/c1-5(8)7-4-2-3-6(7)9;1-6-4-2-3-5(6)7/h5,8H,2-4H2,1H3;2-4H2,1H3.
What are the key properties of 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one?
1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one has a molecular weight of 228.29 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxyethyl)pyrrolidin-2-one;1-methylpyrrolidin-2-one is sourced from PubChem (CID 69298401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).