C38H32N4O — CID 69298492
3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-2-one (PubChem CID 69298492) has the molecular formula C38H32N4O and a molecular weight of 560.70 g/mol. Its IUPAC name is 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-2-one.
| Compound Name | 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-2-one |
|---|---|
| PubChem CID | 69298492 |
| Molecular Formula | C38H32N4O |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-2-one |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C=C3\N=C(/C=C4/C=CC(=N4)/C(c4c(C)cc(C)cc4C)=C4/C=CC2=N4)C(=O)C3(C)C)cc1 |
| InChI | InChI=1S/C38H32N4O/c1-21-7-9-25(10-8-21)35-28-13-12-27(40-28)20-33-38(5,6)37(43)32(42-33)19-26-11-14-30(39-26)36(31-16-15-29(35)41-31)34-23(3)17-22(2)18-24(34)4/h7-20H,1-6H3/b26-19-,27-20-,32-19-,33-20-,35-28-,35-29-,36-30+,36-31+ |
| InChIKey | HCJKCWHLURKYNY-IWGNYBPWSA-N |
| XLogP | 7.91 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |