About disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate
disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate (PubChem CID 69298795) has the molecular formula C6H12NNa2O5PS2
and a molecular weight of 319.25 g/mol. Its IUPAC name is disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate.
Molecular Properties
| Compound Name | disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate |
| PubChem CID | 69298795 |
| Molecular Formula | C6H12NNa2O5PS2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate |
| SMILES | O=P([O-])(CCCN1CCCS1(=O)=O)O[S-].[Na+].[Na+] |
| InChI | InChI=1S/C6H14NO5PS2.2Na/c8-13(9,12-14)5-1-3-7-4-2-6-15(7,10)11;;/h14H,1-6H2,(H,8,9);;/q;2*+1/p-2 |
| InChIKey | HXNILFWCYFNVBZ-UHFFFAOYSA-L |
| XLogP | -6.55 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | -6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate?
The IUPAC name of disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate (CID 69298795) is disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate.
What is the SMILES notation for disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate?
The canonical SMILES for disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate is O=P([O-])(CCCN1CCCS1(=O)=O)O[S-].[Na+].[Na+].
What is the InChIKey of disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate?
The InChIKey is HXNILFWCYFNVBZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H14NO5PS2.2Na/c8-13(9,12-14)5-1-3-7-4-2-6-15(7,10)11;;/h14H,1-6H2,(H,8,9);;/q;2*+1/p-2.
What are the key properties of disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate?
disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate has a molecular weight of 319.25 g/mol, XLogP of -6.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl-sulfidooxyphosphinate is sourced from PubChem (CID 69298795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).