C18H32N2 — CID 69298897
4-tert-butyl-2-(4-tert-butyl-1,2,3,6-tetrahydropyridin-6-yl)-2,3,4,5-tetrahydropyridine (PubChem CID 69298897) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 4-tert-butyl-2-(4-tert-butyl-1,2,3,6-tetrahydropyridin-6-yl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 4-tert-butyl-2-(4-tert-butyl-1,2,3,6-tetrahydropyridin-6-yl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 69298897 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 4-tert-butyl-2-(4-tert-butyl-1,2,3,6-tetrahydropyridin-6-yl)-2,3,4,5-tetrahydropyridine |
| SMILES | CC(C)(C)C1=CC(C2CC(C(C)(C)C)CC=N2)NCC1 |
| InChI | InChI=1S/C18H32N2/c1-17(2,3)13-7-9-19-15(11-13)16-12-14(8-10-20-16)18(4,5)6/h9,12-13,15-16,20H,7-8,10-11H2,1-6H3 |
| InChIKey | XCDLDIAYPYYXBN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|