C17H19N5O8 — CID 69299582
2-(4-nitrophenyl)ethyl (2S,4S,5R)-2-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carboxylate (PubChem CID 69299582) has the molecular formula C17H19N5O8 and a molecular weight of 421.37 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl (2S,4S,5R)-2-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carboxylate.
| Compound Name | 2-(4-nitrophenyl)ethyl (2S,4S,5R)-2-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 69299582 |
| Molecular Formula | C17H19N5O8 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl (2S,4S,5R)-2-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carboxylate |
| SMILES | Nc1ncn([C@@]2(C(=O)OCCc3ccc([N+](=O)[O-])cc3)C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C17H19N5O8/c18-15-19-9-21(16(26)20-15)17(7-12(24)13(8-23)30-17)14(25)29-6-5-10-1-3-11(4-2-10)22(27)28/h1-4,9,12-13,23-24H,5-8H2,(H2,18,20,26)/t12-,13+,17-/m0/s1 |
| InChIKey | HLIXYIYLOGKOJH-AHIWAGSCSA-N |
| XLogP | -1.29 |
| TPSA | 192.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|