About 1,2,3-trimethylsilete
1,2,3-trimethylsilete (PubChem CID 69300071) has the molecular formula C6H10Si
and a molecular weight of 110.23 g/mol. Its IUPAC name is 1,2,3-trimethylsilete.
Molecular Properties
| Compound Name | 1,2,3-trimethylsilete |
| PubChem CID | 69300071 |
| Molecular Formula | C6H10Si |
| Molecular Weight | 110.23 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | 1,2,3-trimethylsilete |
| SMILES | CC1=C[Si](C)=C1C |
| InChI | InChI=1S/C6H10Si/c1-5-4-7(3)6(5)2/h4H,1-3H3 |
| InChIKey | CFFIVCPRQFUTKJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethylsilete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethylsilete?
The IUPAC name of 1,2,3-trimethylsilete (CID 69300071) is 1,2,3-trimethylsilete.
What is the SMILES notation for 1,2,3-trimethylsilete?
The canonical SMILES for 1,2,3-trimethylsilete is CC1=C[Si](C)=C1C.
What is the InChIKey of 1,2,3-trimethylsilete?
The InChIKey is CFFIVCPRQFUTKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Si/c1-5-4-7(3)6(5)2/h4H,1-3H3.
What are the key properties of 1,2,3-trimethylsilete?
1,2,3-trimethylsilete has a molecular weight of 110.23 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethylsilete is sourced from PubChem (CID 69300071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).