C25H29N7O3 — CID 69300427
4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-6-[[(3S)-1,2,3,4,7,8-hexahydroisoquinolin-3-yl]methoxy]imidazo[4,5-c]pyridin-4-yl]-2-methylbut-3-yn-2-ol (PubChem CID 69300427) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-6-[[(3S)-1,2,3,4,7,8-hexahydroisoquinolin-3-yl]methoxy]imidazo[4,5-c]pyridin-4-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-6-[[(3S)-1,2,3,4,7,8-hexahydroisoquinolin-3-yl]methoxy]imidazo[4,5-c]pyridin-4-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 69300427 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-6-[[(3S)-1,2,3,4,7,8-hexahydroisoquinolin-3-yl]methoxy]imidazo[4,5-c]pyridin-4-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CCn1c(-c2nonc2N)nc2c(C#CC(C)(C)O)nc(OC[C@@H]3CC4=C(CCC=C4)CN3)cc21 |
| InChI | InChI=1S/C25H29N7O3/c1-4-32-19-12-20(34-14-17-11-15-7-5-6-8-16(15)13-27-17)28-18(9-10-25(2,3)33)21(19)29-24(32)22-23(26)31-35-30-22/h5,7,12,17,27,33H,4,6,8,11,13-14H2,1-3H3,(H2,26,31)/t17-/m0/s1 |
| InChIKey | XWSJHGGNXDBHEB-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|