C21H24O2 — CID 69300595
2,2,9,14-tetramethyl-7,10-dioxatetracyclo[9.4.2.23,6.012,15]nonadeca-1(15),3(19),4,6(18),11,16-hexaene (PubChem CID 69300595) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2,2,9,14-tetramethyl-7,10-dioxatetracyclo[9.4.2.23,6.012,15]nonadeca-1(15),3(19),4,6(18),11,16-hexaene.
| Compound Name | 2,2,9,14-tetramethyl-7,10-dioxatetracyclo[9.4.2.23,6.012,15]nonadeca-1(15),3(19),4,6(18),11,16-hexaene |
|---|---|
| PubChem CID | 69300595 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,2,9,14-tetramethyl-7,10-dioxatetracyclo[9.4.2.23,6.012,15]nonadeca-1(15),3(19),4,6(18),11,16-hexaene |
| SMILES | CC1COc2ccc(cc2)C(C)(C)c2ccc(c3c2C(C)C3)O1 |
| InChI | InChI=1S/C21H24O2/c1-13-11-17-19-10-9-18(20(13)17)21(3,4)15-5-7-16(8-6-15)22-12-14(2)23-19/h5-10,13-14H,11-12H2,1-4H3 |
| InChIKey | HFMRHTGAXPXVPU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |