About 2-(4-methyl-1,2-oxazol-3-yl)acetic acid
2-(4-methyl-1,2-oxazol-3-yl)acetic acid (PubChem CID 69300639) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 2-(4-methyl-1,2-oxazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-methyl-1,2-oxazol-3-yl)acetic acid |
| PubChem CID | 69300639 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 2-(4-methyl-1,2-oxazol-3-yl)acetic acid |
| SMILES | Cc1conc1CC(=O)O |
| InChI | InChI=1S/C6H7NO3/c1-4-3-10-7-5(4)2-6(8)9/h3H,2H2,1H3,(H,8,9) |
| InChIKey | VHJFFOFGFBUERY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-1,2-oxazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,2-oxazol-3-yl)acetic acid?
The IUPAC name of 2-(4-methyl-1,2-oxazol-3-yl)acetic acid (CID 69300639) is 2-(4-methyl-1,2-oxazol-3-yl)acetic acid.
What is the SMILES notation for 2-(4-methyl-1,2-oxazol-3-yl)acetic acid?
The canonical SMILES for 2-(4-methyl-1,2-oxazol-3-yl)acetic acid is Cc1conc1CC(=O)O.
What is the InChIKey of 2-(4-methyl-1,2-oxazol-3-yl)acetic acid?
The InChIKey is VHJFFOFGFBUERY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c1-4-3-10-7-5(4)2-6(8)9/h3H,2H2,1H3,(H,8,9).
What are the key properties of 2-(4-methyl-1,2-oxazol-3-yl)acetic acid?
2-(4-methyl-1,2-oxazol-3-yl)acetic acid has a molecular weight of 141.13 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,2-oxazol-3-yl)acetic acid is sourced from PubChem (CID 69300639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).