C21H28N2O4 — CID 69301001
(4R,7R,7aR,12bS)-7-amino-9-(methoxymethoxy)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 69301001) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is (4R,7R,7aR,12bS)-7-amino-9-(methoxymethoxy)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,7R,7aR,12bS)-7-amino-9-(methoxymethoxy)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 69301001 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (4R,7R,7aR,12bS)-7-amino-9-(methoxymethoxy)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OCOC)c4O[C@H]2[C@H](N)CCC3(O)[C@H]1C5 |
| InChI | InChI=1S/C21H28N2O4/c1-3-9-23-10-8-20-17-13-4-5-15(26-12-25-2)18(17)27-19(20)14(22)6-7-21(20,24)16(23)11-13/h3-5,14,16,19,24H,1,6-12,22H2,2H3/t14-,16-,19+,20+,21?/m1/s1 |
| InChIKey | LQHXGAMPWYCXAA-RXNKJGSKSA-N |
| XLogP | 1.34 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|