C32H37F3N4O5 — CID 69302040
3-(5-oxo-5-piperazin-1-ylpentanoyl)-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylic acid (PubChem CID 69302040) has the molecular formula C32H37F3N4O5 and a molecular weight of 614.67 g/mol. Its IUPAC name is 3-(5-oxo-5-piperazin-1-ylpentanoyl)-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylic acid.
| Compound Name | 3-(5-oxo-5-piperazin-1-ylpentanoyl)-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 69302040 |
| Molecular Formula | C32H37F3N4O5 |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | 3-(5-oxo-5-piperazin-1-ylpentanoyl)-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylic acid |
| SMILES | O=C(O)C1=C(c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)CC2CN(C(=O)CCCC(=O)N3CCNCC3)CC1N2 |
| InChI | InChI=1S/C32H37F3N4O5/c33-24-10-11-25(34)31(30(24)35)44-16-2-3-20-6-8-21(9-7-20)23-17-22-18-39(19-26(37-22)29(23)32(42)43)28(41)5-1-4-27(40)38-14-12-36-13-15-38/h6-11,22,26,36-37H,1-5,12-19H2,(H,42,43) |
| InChIKey | MFPJLYIIUCXHAX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|