About 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide
5-(hydroxymethyl)benzene-1,3-dicarbohydrazide (PubChem CID 69302191) has the molecular formula C9H12N4O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide |
| PubChem CID | 69302191 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide |
| SMILES | NNC(=O)c1cc(CO)cc(C(=O)NN)c1 |
| InChI | InChI=1S/C9H12N4O3/c10-12-8(15)6-1-5(4-14)2-7(3-6)9(16)13-11/h1-3,14H,4,10-11H2,(H,12,15)(H,13,16) |
| InChIKey | LKBWGZXHSZFVNC-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide?
The IUPAC name of 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide (CID 69302191) is 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide.
What is the SMILES notation for 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide?
The canonical SMILES for 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide is NNC(=O)c1cc(CO)cc(C(=O)NN)c1.
What is the InChIKey of 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide?
The InChIKey is LKBWGZXHSZFVNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3/c10-12-8(15)6-1-5(4-14)2-7(3-6)9(16)13-11/h1-3,14H,4,10-11H2,(H,12,15)(H,13,16).
What are the key properties of 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide?
5-(hydroxymethyl)benzene-1,3-dicarbohydrazide has a molecular weight of 224.22 g/mol, XLogP of -1.61, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)benzene-1,3-dicarbohydrazide is sourced from PubChem (CID 69302191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).